(2-methoxy-2-oxoethyl) 5-methyl-1-benzothiophene-2-carboxylate

C13H12O4S — CID 118424946

IUPAC(2-methoxy-2-oxoethyl) 5-methyl-1-benzothiophene-2-carboxylate
SMILESCOC(=O)COC(=O)c1cc2cc(C)ccc2s1
InChIInChI=1S/C13H12O4S/c1-8-3-4-10-9(5-8)6-11(18-10)13(15)17-7-12(14)16-2/h3-6H,7H2,1-2H3
InChIKeyZQMZLHXRKSXBRX-UHFFFAOYSA-N
MW264.30 g/mol
LogP2.54
Rot. Bonds3

About (2-methoxy-2-oxoethyl) 5-methyl-1-benzothiophene-2-carboxylate

(2-methoxy-2-oxoethyl) 5-methyl-1-benzothiophene-2-carboxylate (PubChem CID 118424946) has the molecular formula C13H12O4S and a molecular weight of 264.30 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 5-methyl-1-benzothiophene-2-carboxylate.

Molecular Properties

Compound Name(2-methoxy-2-oxoethyl) 5-methyl-1-benzothiophene-2-carboxylate
PubChem CID118424946
Molecular FormulaC13H12O4S
Molecular Weight264.30 g/mol
Exact Mass264.05
IUPAC Name(2-methoxy-2-oxoethyl) 5-methyl-1-benzothiophene-2-carboxylate
SMILESCOC(=O)COC(=O)c1cc2cc(C)ccc2s1
InChIInChI=1S/C13H12O4S/c1-8-3-4-10-9(5-8)6-11(18-10)13(15)17-7-12(14)16-2/h3-6H,7H2,1-2H3
InChIKeyZQMZLHXRKSXBRX-UHFFFAOYSA-N
XLogP2.54
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.30
LogP ≤ 52.54
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze (2-methoxy-2-oxoethyl) 5-methyl-1-benzothiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-methoxy-2-oxoethyl) 5-methyl-1-benzothiophene-2-carboxylate?
The IUPAC name of (2-methoxy-2-oxoethyl) 5-methyl-1-benzothiophene-2-carboxylate (CID 118424946) is (2-methoxy-2-oxoethyl) 5-methyl-1-benzothiophene-2-carboxylate.
What is the SMILES notation for (2-methoxy-2-oxoethyl) 5-methyl-1-benzothiophene-2-carboxylate?
The canonical SMILES for (2-methoxy-2-oxoethyl) 5-methyl-1-benzothiophene-2-carboxylate is COC(=O)COC(=O)c1cc2cc(C)ccc2s1.
What is the InChIKey of (2-methoxy-2-oxoethyl) 5-methyl-1-benzothiophene-2-carboxylate?
The InChIKey is ZQMZLHXRKSXBRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O4S/c1-8-3-4-10-9(5-8)6-11(18-10)13(15)17-7-12(14)16-2/h3-6H,7H2,1-2H3.
What are the key properties of (2-methoxy-2-oxoethyl) 5-methyl-1-benzothiophene-2-carboxylate?
(2-methoxy-2-oxoethyl) 5-methyl-1-benzothiophene-2-carboxylate has a molecular weight of 264.30 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-2-oxoethyl) 5-methyl-1-benzothiophene-2-carboxylate is sourced from PubChem (CID 118424946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).