C15H23IN4O2 — CID 118429390
tert-butyl N-[2-[2-(5-iodopyrimidin-2-yl)pyrrolidin-1-yl]ethyl]carbamate (PubChem CID 118429390) has the molecular formula C15H23IN4O2 and a molecular weight of 418.28 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(5-iodopyrimidin-2-yl)pyrrolidin-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(5-iodopyrimidin-2-yl)pyrrolidin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 118429390 |
| Molecular Formula | C15H23IN4O2 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | tert-butyl N-[2-[2-(5-iodopyrimidin-2-yl)pyrrolidin-1-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN1CCCC1c1ncc(I)cn1 |
| InChI | InChI=1S/C15H23IN4O2/c1-15(2,3)22-14(21)17-6-8-20-7-4-5-12(20)13-18-9-11(16)10-19-13/h9-10,12H,4-8H2,1-3H3,(H,17,21) |
| InChIKey | SNDSJRNFOOMDBR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|