C26H37NO3 — CID 11842951
ethyl (1R,5S,9S)-3-(3-phenylpropyl)-9-prop-2-enoxy-5-prop-2-enyl-3-azabicyclo[3.3.1]nonane-1-carboxylate (PubChem CID 11842951) has the molecular formula C26H37NO3 and a molecular weight of 411.59 g/mol. Its IUPAC name is ethyl (1R,5S,9S)-3-(3-phenylpropyl)-9-prop-2-enoxy-5-prop-2-enyl-3-azabicyclo[3.3.1]nonane-1-carboxylate.
| Compound Name | ethyl (1R,5S,9S)-3-(3-phenylpropyl)-9-prop-2-enoxy-5-prop-2-enyl-3-azabicyclo[3.3.1]nonane-1-carboxylate |
|---|---|
| PubChem CID | 11842951 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | ethyl (1R,5S,9S)-3-(3-phenylpropyl)-9-prop-2-enoxy-5-prop-2-enyl-3-azabicyclo[3.3.1]nonane-1-carboxylate |
| SMILES | C=CCO[C@H]1[C@]2(CC=C)CCC[C@@]1(C(=O)OCC)CN(CCCc1ccccc1)C2 |
| InChI | InChI=1S/C26H37NO3/c1-4-15-25-16-11-17-26(24(28)29-6-3,23(25)30-19-5-2)21-27(20-25)18-10-14-22-12-8-7-9-13-22/h4-5,7-9,12-13,23H,1-2,6,10-11,14-21H2,3H3/t23-,25+,26+/m0/s1 |
| InChIKey | IAEVXXCQGYCAHU-SKBVVQJISA-N |
| XLogP | 4.80 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|