C21H25NO3 — CID 146167034
methyl (1S,5R)-7-benzyl-14-oxa-7-azatetracyclo[7.3.2.01,8.05,13]tetradec-10-ene-5-carboxylate (PubChem CID 146167034) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is methyl (1S,5R)-7-benzyl-14-oxa-7-azatetracyclo[7.3.2.01,8.05,13]tetradec-10-ene-5-carboxylate.
| Compound Name | methyl (1S,5R)-7-benzyl-14-oxa-7-azatetracyclo[7.3.2.01,8.05,13]tetradec-10-ene-5-carboxylate |
|---|---|
| PubChem CID | 146167034 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | methyl (1S,5R)-7-benzyl-14-oxa-7-azatetracyclo[7.3.2.01,8.05,13]tetradec-10-ene-5-carboxylate |
| SMILES | COC(=O)[C@@]12CCC[C@@]34CC=CC(OC13)C4N(Cc1ccccc1)C2 |
| InChI | InChI=1S/C21H25NO3/c1-24-19(23)21-12-6-11-20-10-5-9-16(25-18(20)21)17(20)22(14-21)13-15-7-3-2-4-8-15/h2-5,7-9,16-18H,6,10-14H2,1H3/t16?,17?,18?,20-,21-/m1/s1 |
| InChIKey | AVTDMEXIJOJWQZ-BMCGFAJBSA-N |
| XLogP | 2.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|