C24H33NO3 — CID 11844859
ethyl (1S,7S,8R)-10-(3-phenylpropyl)-6-oxa-10-azatricyclo[6.3.3.01,7]tetradec-3-ene-8-carboxylate (PubChem CID 11844859) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is ethyl (1S,7S,8R)-10-(3-phenylpropyl)-6-oxa-10-azatricyclo[6.3.3.01,7]tetradec-3-ene-8-carboxylate.
| Compound Name | ethyl (1S,7S,8R)-10-(3-phenylpropyl)-6-oxa-10-azatricyclo[6.3.3.01,7]tetradec-3-ene-8-carboxylate |
|---|---|
| PubChem CID | 11844859 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | ethyl (1S,7S,8R)-10-(3-phenylpropyl)-6-oxa-10-azatricyclo[6.3.3.01,7]tetradec-3-ene-8-carboxylate |
| SMILES | CCOC(=O)[C@@]12CCC[C@]3(CC=CCO[C@@H]31)CN(CCCc1ccccc1)C2 |
| InChI | InChI=1S/C24H33NO3/c1-2-27-22(26)24-15-9-14-23(13-6-7-17-28-21(23)24)18-25(19-24)16-8-12-20-10-4-3-5-11-20/h3-7,10-11,21H,2,8-9,12-19H2,1H3/t21-,23+,24+/m0/s1 |
| InChIKey | TXOMXAQQSBRFPG-QPTUXGOLSA-N |
| XLogP | 4.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|