C21H25NO3 — CID 146167032
methyl (1S,9R)-7-benzyl-13-oxo-7-azatricyclo[7.3.1.01,6]tridec-4-ene-9-carboxylate (PubChem CID 146167032) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is methyl (1S,9R)-7-benzyl-13-oxo-7-azatricyclo[7.3.1.01,6]tridec-4-ene-9-carboxylate.
| Compound Name | methyl (1S,9R)-7-benzyl-13-oxo-7-azatricyclo[7.3.1.01,6]tridec-4-ene-9-carboxylate |
|---|---|
| PubChem CID | 146167032 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | methyl (1S,9R)-7-benzyl-13-oxo-7-azatricyclo[7.3.1.01,6]tridec-4-ene-9-carboxylate |
| SMILES | COC(=O)[C@]12CCC[C@@]3(CCC=CC3N(Cc3ccccc3)C1)C2=O |
| InChI | InChI=1S/C21H25NO3/c1-25-19(24)21-13-7-12-20(18(21)23)11-6-5-10-17(20)22(15-21)14-16-8-3-2-4-9-16/h2-5,8-10,17H,6-7,11-15H2,1H3/t17?,20-,21-/m1/s1 |
| InChIKey | UIXZEZAPTHMHRE-LTGQRPFBSA-N |
| XLogP | 3.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|