C27H30F2N2O5 — CID 24848574
diethyl 2,4-bis(3-fluorophenyl)-3,7-dimethyl-9-oxo-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate (PubChem CID 24848574) has the molecular formula C27H30F2N2O5 and a molecular weight of 500.54 g/mol. Its IUPAC name is diethyl 2,4-bis(3-fluorophenyl)-3,7-dimethyl-9-oxo-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate.
| Compound Name | diethyl 2,4-bis(3-fluorophenyl)-3,7-dimethyl-9-oxo-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate |
|---|---|
| PubChem CID | 24848574 |
| Molecular Formula | C27H30F2N2O5 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | diethyl 2,4-bis(3-fluorophenyl)-3,7-dimethyl-9-oxo-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate |
| SMILES | CCOC(=O)C12CN(C)CC(C(=O)OCC)(C1=O)C(c1cccc(F)c1)N(C)C2c1cccc(F)c1 |
| InChI | InChI=1S/C27H30F2N2O5/c1-5-35-24(33)26-15-30(3)16-27(23(26)32,25(34)36-6-2)22(18-10-8-12-20(29)14-18)31(4)21(26)17-9-7-11-19(28)13-17/h7-14,21-22H,5-6,15-16H2,1-4H3 |
| InChIKey | QVXWNLINRVQSKM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|