C17H13N7O5 — CID 118433624
2-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-N-[(2-nitrophenyl)methylideneamino]acetamide (PubChem CID 118433624) has the molecular formula C17H13N7O5 and a molecular weight of 395.34 g/mol. Its IUPAC name is 2-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-N-[(2-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-N-[(2-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 118433624 |
| Molecular Formula | C17H13N7O5 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 2-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-N-[(2-nitrophenyl)methylideneamino]acetamide |
| SMILES | O=C(Cn1nnnc1-c1ccc2c(c1)OCO2)NN=Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H13N7O5/c25-16(19-18-8-12-3-1-2-4-13(12)24(26)27)9-23-17(20-21-22-23)11-5-6-14-15(7-11)29-10-28-14/h1-8H,9-10H2,(H,19,25) |
| InChIKey | RMYYDMDLLVNXQP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|