C13H18FN5O — CID 118434107
[1-(5-aminopyridazin-4-yl)piperidin-4-yl]-(3-fluoroazetidin-1-yl)methanone (PubChem CID 118434107) has the molecular formula C13H18FN5O and a molecular weight of 279.32 g/mol. Its IUPAC name is [1-(5-aminopyridazin-4-yl)piperidin-4-yl]-(3-fluoroazetidin-1-yl)methanone.
| Compound Name | [1-(5-aminopyridazin-4-yl)piperidin-4-yl]-(3-fluoroazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 118434107 |
| Molecular Formula | C13H18FN5O |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | [1-(5-aminopyridazin-4-yl)piperidin-4-yl]-(3-fluoroazetidin-1-yl)methanone |
| SMILES | Nc1cnncc1N1CCC(C(=O)N2CC(F)C2)CC1 |
| InChI | InChI=1S/C13H18FN5O/c14-10-7-19(8-10)13(20)9-1-3-18(4-2-9)12-6-17-16-5-11(12)15/h5-6,9-10H,1-4,7-8H2,(H2,15,17) |
| InChIKey | LDIKYLZFLQLBBC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |