C30H22N6O6 — CID 11843595
methyl (1S,5S)-3,6-bis(4-nitrophenyl)-1,5-diphenyl-2,6-diaza-3-azonia-4-azanidabicyclo[3.3.0]octa-2,7-diene-8-carboxylate (PubChem CID 11843595) has the molecular formula C30H22N6O6 and a molecular weight of 562.54 g/mol. Its IUPAC name is methyl (1S,5S)-3,6-bis(4-nitrophenyl)-1,5-diphenyl-2,6-diaza-3-azonia-4-azanidabicyclo[3.3.0]octa-2,7-diene-8-carboxylate.
| Compound Name | methyl (1S,5S)-3,6-bis(4-nitrophenyl)-1,5-diphenyl-2,6-diaza-3-azonia-4-azanidabicyclo[3.3.0]octa-2,7-diene-8-carboxylate |
|---|---|
| PubChem CID | 11843595 |
| Molecular Formula | C30H22N6O6 |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | methyl (1S,5S)-3,6-bis(4-nitrophenyl)-1,5-diphenyl-2,6-diaza-3-azonia-4-azanidabicyclo[3.3.0]octa-2,7-diene-8-carboxylate |
| SMILES | COC(=O)C1=CN(c2ccc([N+](=O)[O-])cc2)[C@@]2(c3ccccc3)[N-][N+](c3ccc([N+](=O)[O-])cc3)=N[C@@]12c1ccccc1 |
| InChI | InChI=1S/C30H22N6O6/c1-42-28(37)27-20-33(23-12-16-25(17-13-23)35(38)39)30(22-10-6-3-7-11-22)29(27,21-8-4-2-5-9-21)31-34(32-30)24-14-18-26(19-15-24)36(40)41/h2-20H,1H3/t29-,30+/m0/s1 |
| InChIKey | MUJVGOZBXPNRAG-XZWHSSHBSA-N |
| XLogP | 6.23 |
| TPSA | 145.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|