C24H24N6O6 — CID 11843596
methyl (1S,8S)-10,12-bis(4-nitrophenyl)-9,12-diaza-10-azonia-11-azanidatricyclo[6.3.3.01,8]tetradeca-9,13-diene-14-carboxylate (PubChem CID 11843596) has the molecular formula C24H24N6O6 and a molecular weight of 492.49 g/mol. Its IUPAC name is methyl (1S,8S)-10,12-bis(4-nitrophenyl)-9,12-diaza-10-azonia-11-azanidatricyclo[6.3.3.01,8]tetradeca-9,13-diene-14-carboxylate.
| Compound Name | methyl (1S,8S)-10,12-bis(4-nitrophenyl)-9,12-diaza-10-azonia-11-azanidatricyclo[6.3.3.01,8]tetradeca-9,13-diene-14-carboxylate |
|---|---|
| PubChem CID | 11843596 |
| Molecular Formula | C24H24N6O6 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | methyl (1S,8S)-10,12-bis(4-nitrophenyl)-9,12-diaza-10-azonia-11-azanidatricyclo[6.3.3.01,8]tetradeca-9,13-diene-14-carboxylate |
| SMILES | COC(=O)C1=CN(c2ccc([N+](=O)[O-])cc2)[C@]23CCCCCC[C@]12N=[N+](c1ccc([N+](=O)[O-])cc1)[N-]3 |
| InChI | InChI=1S/C24H24N6O6/c1-36-22(31)21-16-27(17-6-10-19(11-7-17)29(32)33)24-15-5-3-2-4-14-23(21,24)25-28(26-24)18-8-12-20(13-9-18)30(34)35/h6-13,16H,2-5,14-15H2,1H3/t23-,24+/m0/s1 |
| InChIKey | ITOKWXAKASQCRE-BJKOFHAPSA-N |
| XLogP | 5.27 |
| TPSA | 145.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|