C14H19N5O4 — CID 14472722
methyl 2-methyl-5-(4-nitrophenyl)-6-propan-2-yl-1,6-dihydro-1,2,4,5-tetrazine-3-carboxylate (PubChem CID 14472722) has the molecular formula C14H19N5O4 and a molecular weight of 321.34 g/mol. Its IUPAC name is methyl 2-methyl-5-(4-nitrophenyl)-6-propan-2-yl-1,6-dihydro-1,2,4,5-tetrazine-3-carboxylate.
| Compound Name | methyl 2-methyl-5-(4-nitrophenyl)-6-propan-2-yl-1,6-dihydro-1,2,4,5-tetrazine-3-carboxylate |
|---|---|
| PubChem CID | 14472722 |
| Molecular Formula | C14H19N5O4 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | methyl 2-methyl-5-(4-nitrophenyl)-6-propan-2-yl-1,6-dihydro-1,2,4,5-tetrazine-3-carboxylate |
| SMILES | COC(=O)C1=NN(c2ccc([N+](=O)[O-])cc2)C(C(C)C)NN1C |
| InChI | InChI=1S/C14H19N5O4/c1-9(2)12-15-17(3)13(14(20)23-4)16-18(12)10-5-7-11(8-6-10)19(21)22/h5-9,12,15H,1-4H3 |
| InChIKey | URXHQWVKAUYDFB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|