C18H18ClN5O4 — CID 573820
ethyl 5-(4-chlorophenyl)-2-methyl-6-(4-nitrophenyl)-1,6-dihydro-1,2,4,5-tetrazine-3-carboxylate (PubChem CID 573820) has the molecular formula C18H18ClN5O4 and a molecular weight of 403.83 g/mol. Its IUPAC name is ethyl 5-(4-chlorophenyl)-2-methyl-6-(4-nitrophenyl)-1,6-dihydro-1,2,4,5-tetrazine-3-carboxylate.
| Compound Name | ethyl 5-(4-chlorophenyl)-2-methyl-6-(4-nitrophenyl)-1,6-dihydro-1,2,4,5-tetrazine-3-carboxylate |
|---|---|
| PubChem CID | 573820 |
| Molecular Formula | C18H18ClN5O4 |
| Molecular Weight | 403.83 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | ethyl 5-(4-chlorophenyl)-2-methyl-6-(4-nitrophenyl)-1,6-dihydro-1,2,4,5-tetrazine-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccc(Cl)cc2)C(c2ccc([N+](=O)[O-])cc2)NN1C |
| InChI | InChI=1S/C18H18ClN5O4/c1-3-28-18(25)17-21-23(14-10-6-13(19)7-11-14)16(20-22(17)2)12-4-8-15(9-5-12)24(26)27/h4-11,16,20H,3H2,1-2H3 |
| InChIKey | XBRVHLCGBXQICP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.83 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|