C20H21ClN4O3 — CID 40539049
1-[(3R)-4-tert-butyl-2-(4-chlorophenyl)-3-(4-nitrophenyl)-3H-1,2,4-triazol-5-yl]ethanone (PubChem CID 40539049) has the molecular formula C20H21ClN4O3 and a molecular weight of 400.87 g/mol. Its IUPAC name is 1-[(3R)-4-tert-butyl-2-(4-chlorophenyl)-3-(4-nitrophenyl)-3H-1,2,4-triazol-5-yl]ethanone.
| Compound Name | 1-[(3R)-4-tert-butyl-2-(4-chlorophenyl)-3-(4-nitrophenyl)-3H-1,2,4-triazol-5-yl]ethanone |
|---|---|
| PubChem CID | 40539049 |
| Molecular Formula | C20H21ClN4O3 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 1-[(3R)-4-tert-butyl-2-(4-chlorophenyl)-3-(4-nitrophenyl)-3H-1,2,4-triazol-5-yl]ethanone |
| SMILES | CC(=O)C1=NN(c2ccc(Cl)cc2)[C@H](c2ccc([N+](=O)[O-])cc2)N1C(C)(C)C |
| InChI | InChI=1S/C20H21ClN4O3/c1-13(26)18-22-24(16-11-7-15(21)8-12-16)19(23(18)20(2,3)4)14-5-9-17(10-6-14)25(27)28/h5-12,19H,1-4H3/t19-/m1/s1 |
| InChIKey | LQYVVBNBZGUZJZ-LJQANCHMSA-N |
| XLogP | 4.77 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|