C20H18N4O6 — CID 100930760
dimethyl 5-(4-nitrophenyl)-3,4,5-triazatetracyclo[5.4.2.02,6.08,11]trideca-3,9,12-triene-12,13-dicarboxylate (PubChem CID 100930760) has the molecular formula C20H18N4O6 and a molecular weight of 410.39 g/mol. Its IUPAC name is dimethyl 5-(4-nitrophenyl)-3,4,5-triazatetracyclo[5.4.2.02,6.08,11]trideca-3,9,12-triene-12,13-dicarboxylate.
| Compound Name | dimethyl 5-(4-nitrophenyl)-3,4,5-triazatetracyclo[5.4.2.02,6.08,11]trideca-3,9,12-triene-12,13-dicarboxylate |
|---|---|
| PubChem CID | 100930760 |
| Molecular Formula | C20H18N4O6 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | dimethyl 5-(4-nitrophenyl)-3,4,5-triazatetracyclo[5.4.2.02,6.08,11]trideca-3,9,12-triene-12,13-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2C3C=CC3C1C1N=NN(c3ccc([N+](=O)[O-])cc3)C12 |
| InChI | InChI=1S/C20H18N4O6/c1-29-19(25)15-13-11-7-8-12(11)14(16(15)20(26)30-2)18-17(13)21-22-23(18)9-3-5-10(6-4-9)24(27)28/h3-8,11-14,17-18H,1-2H3 |
| InChIKey | XBZLCPPOSQPCHV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 123.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|