C13H14N4O3 — CID 5134021
5-(4-nitrophenyl)-3,4,5-triazatricyclo[5.2.1.02,6]dec-3-en-10-ol (PubChem CID 5134021) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 5-(4-nitrophenyl)-3,4,5-triazatricyclo[5.2.1.02,6]dec-3-en-10-ol.
| Compound Name | 5-(4-nitrophenyl)-3,4,5-triazatricyclo[5.2.1.02,6]dec-3-en-10-ol |
|---|---|
| PubChem CID | 5134021 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 5-(4-nitrophenyl)-3,4,5-triazatricyclo[5.2.1.02,6]dec-3-en-10-ol |
| SMILES | O=[N+]([O-])c1ccc(N2N=NC3C4CCC(C4O)C32)cc1 |
| InChI | InChI=1S/C13H14N4O3/c18-13-9-5-6-10(13)12-11(9)14-15-16(12)7-1-3-8(4-2-7)17(19)20/h1-4,9-13,18H,5-6H2 |
| InChIKey | VOSJGMSTQWUUOC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 91.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|