C17H24N6O2 — CID 12582044
1-(4-nitrophenyl)-5-pyrrolidin-1-yl-4-(pyrrolidin-1-ylmethyl)-4,5-dihydrotriazole (PubChem CID 12582044) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-5-pyrrolidin-1-yl-4-(pyrrolidin-1-ylmethyl)-4,5-dihydrotriazole.
| Compound Name | 1-(4-nitrophenyl)-5-pyrrolidin-1-yl-4-(pyrrolidin-1-ylmethyl)-4,5-dihydrotriazole |
|---|---|
| PubChem CID | 12582044 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 1-(4-nitrophenyl)-5-pyrrolidin-1-yl-4-(pyrrolidin-1-ylmethyl)-4,5-dihydrotriazole |
| SMILES | O=[N+]([O-])c1ccc(N2N=NC(CN3CCCC3)C2N2CCCC2)cc1 |
| InChI | InChI=1S/C17H24N6O2/c24-23(25)15-7-5-14(6-8-15)22-17(21-11-3-4-12-21)16(18-19-22)13-20-9-1-2-10-20/h5-8,16-17H,1-4,9-13H2 |
| InChIKey | IJECOPOMLMCADX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 77.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|