C18H19N5O2 — CID 23252792
(3aS,5R,9bS)-5-ethyl-4-methyl-3-(4-nitrophenyl)-5,9b-dihydro-3aH-triazolo[4,5-c]isoquinoline (PubChem CID 23252792) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is (3aS,5R,9bS)-5-ethyl-4-methyl-3-(4-nitrophenyl)-5,9b-dihydro-3aH-triazolo[4,5-c]isoquinoline.
| Compound Name | (3aS,5R,9bS)-5-ethyl-4-methyl-3-(4-nitrophenyl)-5,9b-dihydro-3aH-triazolo[4,5-c]isoquinoline |
|---|---|
| PubChem CID | 23252792 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (3aS,5R,9bS)-5-ethyl-4-methyl-3-(4-nitrophenyl)-5,9b-dihydro-3aH-triazolo[4,5-c]isoquinoline |
| SMILES | CC[C@@H]1c2ccccc2[C@@H]2N=NN(c3ccc([N+](=O)[O-])cc3)[C@@H]2N1C |
| InChI | InChI=1S/C18H19N5O2/c1-3-16-14-6-4-5-7-15(14)17-18(21(16)2)22(20-19-17)12-8-10-13(11-9-12)23(24)25/h4-11,16-18H,3H2,1-2H3/t16-,17+,18+/m1/s1 |
| InChIKey | CDQZQRGIOMXDPN-SQNIBIBYSA-N |
| XLogP | 4.25 |
| TPSA | 74.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|