About 1-methyl-5-nitroazonine
1-methyl-5-nitroazonine (PubChem CID 144831844) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 1-methyl-5-nitroazonine.
Molecular Properties
| Compound Name | 1-methyl-5-nitroazonine |
| PubChem CID | 144831844 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 1-methyl-5-nitroazonine |
| SMILES | Cn1ccccc([N+](=O)[O-])ccc1 |
| InChI | InChI=1S/C9H10N2O2/c1-10-7-3-2-5-9(11(12)13)6-4-8-10/h2-8H,1H3/b5-2-,7-3-,8-4-,9-6+ |
| InChIKey | YQNLOQOZDFCXJA-GZVKFSDKSA-N |
| XLogP | 2.06 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-5-nitroazonine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-nitroazonine?
The IUPAC name of 1-methyl-5-nitroazonine (CID 144831844) is 1-methyl-5-nitroazonine.
What is the SMILES notation for 1-methyl-5-nitroazonine?
The canonical SMILES for 1-methyl-5-nitroazonine is Cn1ccccc([N+](=O)[O-])ccc1.
What is the InChIKey of 1-methyl-5-nitroazonine?
The InChIKey is YQNLOQOZDFCXJA-GZVKFSDKSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-10-7-3-2-5-9(11(12)13)6-4-8-10/h2-8H,1H3/b5-2-,7-3-,8-4-,9-6+.
What are the key properties of 1-methyl-5-nitroazonine?
1-methyl-5-nitroazonine has a molecular weight of 178.19 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-nitroazonine is sourced from PubChem (CID 144831844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).