C15H18N2O2 — CID 101109083
1-[(2E,4E)-5-(4-nitrophenyl)penta-2,4-dienyl]pyrrolidine (PubChem CID 101109083) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 1-[(2E,4E)-5-(4-nitrophenyl)penta-2,4-dienyl]pyrrolidine.
| Compound Name | 1-[(2E,4E)-5-(4-nitrophenyl)penta-2,4-dienyl]pyrrolidine |
|---|---|
| PubChem CID | 101109083 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 1-[(2E,4E)-5-(4-nitrophenyl)penta-2,4-dienyl]pyrrolidine |
| SMILES | O=[N+]([O-])c1ccc(/C=C/C=C/CN2CCCC2)cc1 |
| InChI | InChI=1S/C15H18N2O2/c18-17(19)15-9-7-14(8-10-15)6-2-1-3-11-16-12-4-5-13-16/h1-3,6-10H,4-5,11-13H2/b3-1+,6-2+ |
| InChIKey | XKRLMRXDRXRRKB-DHWRHDBVSA-N |
| XLogP | 3.26 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|