C24H22N6O8 — CID 15636601
dimethyl 8,10-bis(4-nitrophenyl)-7,10-diaza-8-azonia-9-azanidatricyclo[4.3.3.01,6]dodeca-7,11-diene-11,12-dicarboxylate (PubChem CID 15636601) has the molecular formula C24H22N6O8 and a molecular weight of 522.47 g/mol. Its IUPAC name is dimethyl 8,10-bis(4-nitrophenyl)-7,10-diaza-8-azonia-9-azanidatricyclo[4.3.3.01,6]dodeca-7,11-diene-11,12-dicarboxylate.
| Compound Name | dimethyl 8,10-bis(4-nitrophenyl)-7,10-diaza-8-azonia-9-azanidatricyclo[4.3.3.01,6]dodeca-7,11-diene-11,12-dicarboxylate |
|---|---|
| PubChem CID | 15636601 |
| Molecular Formula | C24H22N6O8 |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | dimethyl 8,10-bis(4-nitrophenyl)-7,10-diaza-8-azonia-9-azanidatricyclo[4.3.3.01,6]dodeca-7,11-diene-11,12-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C23CCCCC2([N-][N+](c2ccc([N+](=O)[O-])cc2)=N3)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H22N6O8/c1-37-21(31)19-20(22(32)38-2)27(15-5-9-17(10-6-15)29(33)34)24-14-4-3-13-23(19,24)25-28(26-24)16-7-11-18(12-8-16)30(35)36/h5-12H,3-4,13-14H2,1-2H3 |
| InChIKey | DZERKNCEKMONKS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 171.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|