C32H26N4O4 — CID 11027831
dimethyl (1S,5S)-1,3,5,6-tetraphenyl-2,6-diaza-3-azonia-4-azanidabicyclo[3.3.0]octa-2,7-diene-7,8-dicarboxylate (PubChem CID 11027831) has the molecular formula C32H26N4O4 and a molecular weight of 530.58 g/mol. Its IUPAC name is dimethyl (1S,5S)-1,3,5,6-tetraphenyl-2,6-diaza-3-azonia-4-azanidabicyclo[3.3.0]octa-2,7-diene-7,8-dicarboxylate.
| Compound Name | dimethyl (1S,5S)-1,3,5,6-tetraphenyl-2,6-diaza-3-azonia-4-azanidabicyclo[3.3.0]octa-2,7-diene-7,8-dicarboxylate |
|---|---|
| PubChem CID | 11027831 |
| Molecular Formula | C32H26N4O4 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | dimethyl (1S,5S)-1,3,5,6-tetraphenyl-2,6-diaza-3-azonia-4-azanidabicyclo[3.3.0]octa-2,7-diene-7,8-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@]2(c3ccccc3)N=[N+](c3ccccc3)[N-][C@]2(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C32H26N4O4/c1-39-29(37)27-28(30(38)40-2)35(25-19-11-5-12-20-25)32(24-17-9-4-10-18-24)31(27,23-15-7-3-8-16-23)33-36(34-32)26-21-13-6-14-22-26/h3-22H,1-2H3/t31-,32+/m0/s1 |
| InChIKey | GLULCASBPISRHL-AJQTZOPKSA-N |
| XLogP | 5.95 |
| TPSA | 85.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|