C37H32N2O6 — CID 10054309
6-O-ethyl 4-O,5-O-dimethyl 1,2,3,3a-tetraphenyl-6H-pyrrolo[1,2-b]pyrazole-4,5,6-tricarboxylate (PubChem CID 10054309) has the molecular formula C37H32N2O6 and a molecular weight of 600.67 g/mol. Its IUPAC name is 6-O-ethyl 4-O,5-O-dimethyl 1,2,3,3a-tetraphenyl-6H-pyrrolo[1,2-b]pyrazole-4,5,6-tricarboxylate.
| Compound Name | 6-O-ethyl 4-O,5-O-dimethyl 1,2,3,3a-tetraphenyl-6H-pyrrolo[1,2-b]pyrazole-4,5,6-tricarboxylate |
|---|---|
| PubChem CID | 10054309 |
| Molecular Formula | C37H32N2O6 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | 6-O-ethyl 4-O,5-O-dimethyl 1,2,3,3a-tetraphenyl-6H-pyrrolo[1,2-b]pyrazole-4,5,6-tricarboxylate |
| SMILES | CCOC(=O)C1C(C(=O)OC)=C(C(=O)OC)C2(c3ccccc3)C(c3ccccc3)=C(c3ccccc3)N(c3ccccc3)N12 |
| InChI | InChI=1S/C37H32N2O6/c1-4-45-36(42)33-29(34(40)43-2)31(35(41)44-3)37(27-21-13-7-14-22-27)30(25-17-9-5-10-18-25)32(26-19-11-6-12-20-26)38(39(33)37)28-23-15-8-16-24-28/h5-24,33H,4H2,1-3H3 |
| InChIKey | PLWDDHWFXIEQRC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|