C24H22N2O6 — CID 11259073
dimethyl 6-(2-methoxy-2-oxoethyl)-3-phenyl-2H-pyrazolo[5,1-a]isoquinoline-1,2-dicarboxylate (PubChem CID 11259073) has the molecular formula C24H22N2O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is dimethyl 6-(2-methoxy-2-oxoethyl)-3-phenyl-2H-pyrazolo[5,1-a]isoquinoline-1,2-dicarboxylate.
| Compound Name | dimethyl 6-(2-methoxy-2-oxoethyl)-3-phenyl-2H-pyrazolo[5,1-a]isoquinoline-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11259073 |
| Molecular Formula | C24H22N2O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | dimethyl 6-(2-methoxy-2-oxoethyl)-3-phenyl-2H-pyrazolo[5,1-a]isoquinoline-1,2-dicarboxylate |
| SMILES | COC(=O)CC1=CN2C(=C(C(=O)OC)C(C(=O)OC)N2c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C24H22N2O6/c1-30-19(27)13-15-14-25-21(18-12-8-7-11-17(15)18)20(23(28)31-2)22(24(29)32-3)26(25)16-9-5-4-6-10-16/h4-12,14,22H,13H2,1-3H3 |
| InChIKey | OCWMHAVYADRKPI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|