C25H27NO8 — CID 134836834
tetraethyl 11bH-benzo[h]quinolizine-1,2,3,4-tetracarboxylate (PubChem CID 134836834) has the molecular formula C25H27NO8 and a molecular weight of 469.49 g/mol. Its IUPAC name is tetraethyl 11bH-benzo[h]quinolizine-1,2,3,4-tetracarboxylate.
| Compound Name | tetraethyl 11bH-benzo[h]quinolizine-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 134836834 |
| Molecular Formula | C25H27NO8 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | tetraethyl 11bH-benzo[h]quinolizine-1,2,3,4-tetracarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C2c3ccccc3C=CN2C(C(=O)OCC)=C1C(=O)OCC |
| InChI | InChI=1S/C25H27NO8/c1-5-31-22(27)17-18(23(28)32-6-2)20-16-12-10-9-11-15(16)13-14-26(20)21(25(30)34-8-4)19(17)24(29)33-7-3/h9-14,20H,5-8H2,1-4H3 |
| InChIKey | VGUSZWTWZIGQDH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|