C27H27NO8 — CID 9499924
tetramethyl (2S)-1-phenyl-2-(2-phenylethyl)-2H-pyridine-3,4,5,6-tetracarboxylate (PubChem CID 9499924) has the molecular formula C27H27NO8 and a molecular weight of 493.51 g/mol. Its IUPAC name is tetramethyl (2S)-1-phenyl-2-(2-phenylethyl)-2H-pyridine-3,4,5,6-tetracarboxylate.
| Compound Name | tetramethyl (2S)-1-phenyl-2-(2-phenylethyl)-2H-pyridine-3,4,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 9499924 |
| Molecular Formula | C27H27NO8 |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | tetramethyl (2S)-1-phenyl-2-(2-phenylethyl)-2H-pyridine-3,4,5,6-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@H](CCc2ccccc2)N(c2ccccc2)C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C27H27NO8/c1-33-24(29)20-19(16-15-17-11-7-5-8-12-17)28(18-13-9-6-10-14-18)23(27(32)36-4)22(26(31)35-3)21(20)25(30)34-2/h5-14,19H,15-16H2,1-4H3/t19-/m0/s1 |
| InChIKey | HEZMXIHXANXHGO-IBGZPJMESA-N |
| XLogP | 2.75 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|