C34H30N4O6 — CID 134869979
dimethyl (1S,5S)-3,6-bis(4-methoxyphenyl)-1,5-diphenyl-2,6-diaza-3-azonia-4-azanidabicyclo[3.3.0]octa-2,7-diene-7,8-dicarboxylate (PubChem CID 134869979) has the molecular formula C34H30N4O6 and a molecular weight of 590.64 g/mol. Its IUPAC name is dimethyl (1S,5S)-3,6-bis(4-methoxyphenyl)-1,5-diphenyl-2,6-diaza-3-azonia-4-azanidabicyclo[3.3.0]octa-2,7-diene-7,8-dicarboxylate.
| Compound Name | dimethyl (1S,5S)-3,6-bis(4-methoxyphenyl)-1,5-diphenyl-2,6-diaza-3-azonia-4-azanidabicyclo[3.3.0]octa-2,7-diene-7,8-dicarboxylate |
|---|---|
| PubChem CID | 134869979 |
| Molecular Formula | C34H30N4O6 |
| Molecular Weight | 590.64 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | dimethyl (1S,5S)-3,6-bis(4-methoxyphenyl)-1,5-diphenyl-2,6-diaza-3-azonia-4-azanidabicyclo[3.3.0]octa-2,7-diene-7,8-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@]2(c3ccccc3)N=[N+](c3ccc(OC)cc3)[N-][C@]2(c2ccccc2)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C34H30N4O6/c1-41-27-19-15-25(16-20-27)37-30(32(40)44-4)29(31(39)43-3)33(23-11-7-5-8-12-23)34(37,24-13-9-6-10-14-24)36-38(35-33)26-17-21-28(42-2)22-18-26/h5-22H,1-4H3/t33-,34+/m0/s1 |
| InChIKey | JEKUSTYNTZHWJS-SZAHLOSFSA-N |
| XLogP | 5.97 |
| TPSA | 103.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.64 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|