C38H34N4O7 — CID 51346507
dimethyl 6-(1-methoxy-1-oxopropan-2-ylidene)-7-(4-methoxyphenyl)-1,3,4-triphenyl-1,2,4,7-tetrazaspiro[4.4]nona-2,8-diene-8,9-dicarboxylate (PubChem CID 51346507) has the molecular formula C38H34N4O7 and a molecular weight of 658.71 g/mol. Its IUPAC name is dimethyl 6-(1-methoxy-1-oxopropan-2-ylidene)-7-(4-methoxyphenyl)-1,3,4-triphenyl-1,2,4,7-tetrazaspiro[4.4]nona-2,8-diene-8,9-dicarboxylate.
| Compound Name | dimethyl 6-(1-methoxy-1-oxopropan-2-ylidene)-7-(4-methoxyphenyl)-1,3,4-triphenyl-1,2,4,7-tetrazaspiro[4.4]nona-2,8-diene-8,9-dicarboxylate |
|---|---|
| PubChem CID | 51346507 |
| Molecular Formula | C38H34N4O7 |
| Molecular Weight | 658.71 g/mol |
| Exact Mass | 658.24 |
| IUPAC Name | dimethyl 6-(1-methoxy-1-oxopropan-2-ylidene)-7-(4-methoxyphenyl)-1,3,4-triphenyl-1,2,4,7-tetrazaspiro[4.4]nona-2,8-diene-8,9-dicarboxylate |
| SMILES | COC(=O)C(C)=C1N(c2ccc(OC)cc2)C(C(=O)OC)=C(C(=O)OC)C12N(c1ccccc1)N=C(c1ccccc1)N2c1ccccc1 |
| InChI | InChI=1S/C38H34N4O7/c1-25(35(43)47-3)33-38(31(36(44)48-4)32(37(45)49-5)40(33)27-21-23-30(46-2)24-22-27)41(28-17-11-7-12-18-28)34(26-15-9-6-10-16-26)39-42(38)29-19-13-8-14-20-29/h6-24H,1-5H3 |
| InChIKey | BDFCKBFARIAODZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 110.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.71 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|