C37H32N4O6 — CID 44551542
dimethyl (6E)-6-(1-methoxy-1-oxopropan-2-ylidene)-1,3,4,7-tetraphenyl-1,2,4,7-tetrazaspiro[4.4]nona-2,8-diene-8,9-dicarboxylate (PubChem CID 44551542) has the molecular formula C37H32N4O6 and a molecular weight of 628.69 g/mol. Its IUPAC name is dimethyl (6E)-6-(1-methoxy-1-oxopropan-2-ylidene)-1,3,4,7-tetraphenyl-1,2,4,7-tetrazaspiro[4.4]nona-2,8-diene-8,9-dicarboxylate.
| Compound Name | dimethyl (6E)-6-(1-methoxy-1-oxopropan-2-ylidene)-1,3,4,7-tetraphenyl-1,2,4,7-tetrazaspiro[4.4]nona-2,8-diene-8,9-dicarboxylate |
|---|---|
| PubChem CID | 44551542 |
| Molecular Formula | C37H32N4O6 |
| Molecular Weight | 628.69 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | dimethyl (6E)-6-(1-methoxy-1-oxopropan-2-ylidene)-1,3,4,7-tetraphenyl-1,2,4,7-tetrazaspiro[4.4]nona-2,8-diene-8,9-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(/C(=C(/C)C(=O)OC)N1c1ccccc1)N(c1ccccc1)N=C(c1ccccc1)N2c1ccccc1 |
| InChI | InChI=1S/C37H32N4O6/c1-25(34(42)45-2)32-37(30(35(43)46-3)31(36(44)47-4)39(32)27-19-11-6-12-20-27)40(28-21-13-7-14-22-28)33(26-17-9-5-10-18-26)38-41(37)29-23-15-8-16-24-29/h5-24H,1-4H3/b32-25+ |
| InChIKey | WLOBGYDPCMKRTC-WGPBWIAQSA-N |
| XLogP | 5.64 |
| TPSA | 100.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|