C12H20O3S — CID 118437193
2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid (PubChem CID 118437193) has the molecular formula C12H20O3S and a molecular weight of 244.36 g/mol. Its IUPAC name is 2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid.
| Compound Name | 2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid |
|---|---|
| PubChem CID | 118437193 |
| Molecular Formula | C12H20O3S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid |
| SMILES | CC(C)=CCCC(C)(CC=O)SCC(=O)O |
| InChI | InChI=1S/C12H20O3S/c1-10(2)5-4-6-12(3,7-8-13)16-9-11(14)15/h5,8H,4,6-7,9H2,1-3H3,(H,14,15) |
| InChIKey | MRIZMUKTYFONKK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|