2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid

C12H20O3S — CID 118437193

IUPAC2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid
SMILESCC(C)=CCCC(C)(CC=O)SCC(=O)O
InChIInChI=1S/C12H20O3S/c1-10(2)5-4-6-12(3,7-8-13)16-9-11(14)15/h5,8H,4,6-7,9H2,1-3H3,(H,14,15)
InChIKeyMRIZMUKTYFONKK-UHFFFAOYSA-N
MW244.36 g/mol
LogP2.90
Rot. Bonds8

About 2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid

2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid (PubChem CID 118437193) has the molecular formula C12H20O3S and a molecular weight of 244.36 g/mol. Its IUPAC name is 2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid.

Molecular Properties

Compound Name2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid
PubChem CID118437193
Molecular FormulaC12H20O3S
Molecular Weight244.36 g/mol
Exact Mass244.11
IUPAC Name2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid
SMILESCC(C)=CCCC(C)(CC=O)SCC(=O)O
InChIInChI=1S/C12H20O3S/c1-10(2)5-4-6-12(3,7-8-13)16-9-11(14)15/h5,8H,4,6-7,9H2,1-3H3,(H,14,15)
InChIKeyMRIZMUKTYFONKK-UHFFFAOYSA-N
XLogP2.90
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.36
LogP ≤ 52.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid?
The IUPAC name of 2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid (CID 118437193) is 2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid.
What is the SMILES notation for 2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid?
The canonical SMILES for 2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid is CC(C)=CCCC(C)(CC=O)SCC(=O)O.
What is the InChIKey of 2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid?
The InChIKey is MRIZMUKTYFONKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3S/c1-10(2)5-4-6-12(3,7-8-13)16-9-11(14)15/h5,8H,4,6-7,9H2,1-3H3,(H,14,15).
What are the key properties of 2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid?
2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid has a molecular weight of 244.36 g/mol, XLogP of 2.90, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,7-dimethyl-1-oxooct-6-en-3-yl)sulfanylacetic acid is sourced from PubChem (CID 118437193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).