C30H32F2I2N2O5 — CID 118440801
(4S,5S,6S)-N,N-bis[(2,4-dimethoxyphenyl)methyl]-5-fluoro-4-(2-fluorophenyl)-4-iodo-6-[(1S)-1-iodoethyl]-5,6-dihydro-1,3-oxazin-2-amine (PubChem CID 118440801) has the molecular formula C30H32F2I2N2O5 and a molecular weight of 792.40 g/mol. Its IUPAC name is (4S,5S,6S)-N,N-bis[(2,4-dimethoxyphenyl)methyl]-5-fluoro-4-(2-fluorophenyl)-4-iodo-6-[(1S)-1-iodoethyl]-5,6-dihydro-1,3-oxazin-2-amine.
| Compound Name | (4S,5S,6S)-N,N-bis[(2,4-dimethoxyphenyl)methyl]-5-fluoro-4-(2-fluorophenyl)-4-iodo-6-[(1S)-1-iodoethyl]-5,6-dihydro-1,3-oxazin-2-amine |
|---|---|
| PubChem CID | 118440801 |
| Molecular Formula | C30H32F2I2N2O5 |
| Molecular Weight | 792.40 g/mol |
| Exact Mass | 792.04 |
| IUPAC Name | (4S,5S,6S)-N,N-bis[(2,4-dimethoxyphenyl)methyl]-5-fluoro-4-(2-fluorophenyl)-4-iodo-6-[(1S)-1-iodoethyl]-5,6-dihydro-1,3-oxazin-2-amine |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2OC)C2=N[C@](I)(c3ccccc3F)[C@@H](F)[C@@H]([C@H](C)I)O2)c(OC)c1 |
| InChI | InChI=1S/C30H32F2I2N2O5/c1-18(33)27-28(32)30(34,23-8-6-7-9-24(23)31)35-29(41-27)36(16-19-10-12-21(37-2)14-25(19)39-4)17-20-11-13-22(38-3)15-26(20)40-5/h6-15,18,27-28H,16-17H2,1-5H3/t18-,27+,28-,30+/m0/s1 |
| InChIKey | NWPGBUCCPJWBHU-FGRIMGPOSA-N |
| XLogP | 7.07 |
| TPSA | 61.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.40 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|