C29H31BrF2IN3O5 — CID 169493681
4-(6-bromo-3-fluoro-2-pyridinyl)-N,N-bis[(2,4-dimethoxyphenyl)methyl]-5-fluoro-6-(iodomethyl)-4-methyl-5,6-dihydro-1,3-oxazin-2-amine (PubChem CID 169493681) has the molecular formula C29H31BrF2IN3O5 and a molecular weight of 746.39 g/mol. Its IUPAC name is 4-(6-bromo-3-fluoro-2-pyridinyl)-N,N-bis[(2,4-dimethoxyphenyl)methyl]-5-fluoro-6-(iodomethyl)-4-methyl-5,6-dihydro-1,3-oxazin-2-amine.
| Compound Name | 4-(6-bromo-3-fluoro-2-pyridinyl)-N,N-bis[(2,4-dimethoxyphenyl)methyl]-5-fluoro-6-(iodomethyl)-4-methyl-5,6-dihydro-1,3-oxazin-2-amine |
|---|---|
| PubChem CID | 169493681 |
| Molecular Formula | C29H31BrF2IN3O5 |
| Molecular Weight | 746.39 g/mol |
| Exact Mass | 745.05 |
| IUPAC Name | 4-(6-bromo-3-fluoro-2-pyridinyl)-N,N-bis[(2,4-dimethoxyphenyl)methyl]-5-fluoro-6-(iodomethyl)-4-methyl-5,6-dihydro-1,3-oxazin-2-amine |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2OC)C2=NC(C)(c3nc(Br)ccc3F)C(F)C(CI)O2)c(OC)c1 |
| InChI | InChI=1S/C29H31BrF2IN3O5/c1-29(27-21(31)10-11-25(30)34-27)26(32)24(14-33)41-28(35-29)36(15-17-6-8-19(37-2)12-22(17)39-4)16-18-7-9-20(38-3)13-23(18)40-5/h6-13,24,26H,14-16H2,1-5H3 |
| InChIKey | AZYCGGXBRJMFDQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 74.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.39 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|