C21H15F4N3O2 — CID 118443856
5-[1-[5-[2-fluoro-4-(trifluoromethoxy)phenyl]-2-pyridinyl]-1-prop-2-ynoxyethyl]pyrimidine (PubChem CID 118443856) has the molecular formula C21H15F4N3O2 and a molecular weight of 417.36 g/mol. Its IUPAC name is 5-[1-[5-[2-fluoro-4-(trifluoromethoxy)phenyl]-2-pyridinyl]-1-prop-2-ynoxyethyl]pyrimidine.
| Compound Name | 5-[1-[5-[2-fluoro-4-(trifluoromethoxy)phenyl]-2-pyridinyl]-1-prop-2-ynoxyethyl]pyrimidine |
|---|---|
| PubChem CID | 118443856 |
| Molecular Formula | C21H15F4N3O2 |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 5-[1-[5-[2-fluoro-4-(trifluoromethoxy)phenyl]-2-pyridinyl]-1-prop-2-ynoxyethyl]pyrimidine |
| SMILES | C#CCOC(C)(c1cncnc1)c1ccc(-c2ccc(OC(F)(F)F)cc2F)cn1 |
| InChI | InChI=1S/C21H15F4N3O2/c1-3-8-29-20(2,15-11-26-13-27-12-15)19-7-4-14(10-28-19)17-6-5-16(9-18(17)22)30-21(23,24)25/h1,4-7,9-13H,8H2,2H3 |
| InChIKey | PDSPMOYQMSAJCW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|