C20H13F4N3O2 — CID 118431490
1-[5-[2-fluoro-4-(trifluoromethoxy)phenyl]-2-pyridinyl]-1-pyrimidin-5-ylbut-2-yn-1-ol (PubChem CID 118431490) has the molecular formula C20H13F4N3O2 and a molecular weight of 403.34 g/mol. Its IUPAC name is 1-[5-[2-fluoro-4-(trifluoromethoxy)phenyl]-2-pyridinyl]-1-pyrimidin-5-ylbut-2-yn-1-ol.
| Compound Name | 1-[5-[2-fluoro-4-(trifluoromethoxy)phenyl]-2-pyridinyl]-1-pyrimidin-5-ylbut-2-yn-1-ol |
|---|---|
| PubChem CID | 118431490 |
| Molecular Formula | C20H13F4N3O2 |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 1-[5-[2-fluoro-4-(trifluoromethoxy)phenyl]-2-pyridinyl]-1-pyrimidin-5-ylbut-2-yn-1-ol |
| SMILES | CC#CC(O)(c1cncnc1)c1ccc(-c2ccc(OC(F)(F)F)cc2F)cn1 |
| InChI | InChI=1S/C20H13F4N3O2/c1-2-7-19(28,14-10-25-12-26-11-14)18-6-3-13(9-27-18)16-5-4-15(8-17(16)21)29-20(22,23)24/h3-6,8-12,28H,1H3 |
| InChIKey | YQDNWFGWJNHIFB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|