C21H18F3N3O3 — CID 118455075
2-cyclopropyl-2-pyrimidin-5-yl-2-[5-[4-(trifluoromethoxy)phenoxy]-2-pyridinyl]ethanol (PubChem CID 118455075) has the molecular formula C21H18F3N3O3 and a molecular weight of 417.39 g/mol. Its IUPAC name is 2-cyclopropyl-2-pyrimidin-5-yl-2-[5-[4-(trifluoromethoxy)phenoxy]-2-pyridinyl]ethanol.
| Compound Name | 2-cyclopropyl-2-pyrimidin-5-yl-2-[5-[4-(trifluoromethoxy)phenoxy]-2-pyridinyl]ethanol |
|---|---|
| PubChem CID | 118455075 |
| Molecular Formula | C21H18F3N3O3 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-cyclopropyl-2-pyrimidin-5-yl-2-[5-[4-(trifluoromethoxy)phenoxy]-2-pyridinyl]ethanol |
| SMILES | OCC(c1cncnc1)(c1ccc(Oc2ccc(OC(F)(F)F)cc2)cn1)C1CC1 |
| InChI | InChI=1S/C21H18F3N3O3/c22-21(23,24)30-17-5-3-16(4-6-17)29-18-7-8-19(27-11-18)20(12-28,14-1-2-14)15-9-25-13-26-10-15/h3-11,13-14,28H,1-2,12H2 |
| InChIKey | PKSBGKUMKXTMQV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |