C16H31N3O4 — CID 118449429
tert-butyl (4S)-4-[[(3S)-3,7-diamino-2-oxoheptyl]amino]-3-oxopentanoate (PubChem CID 118449429) has the molecular formula C16H31N3O4 and a molecular weight of 329.44 g/mol. Its IUPAC name is tert-butyl (4S)-4-[[(3S)-3,7-diamino-2-oxoheptyl]amino]-3-oxopentanoate.
| Compound Name | tert-butyl (4S)-4-[[(3S)-3,7-diamino-2-oxoheptyl]amino]-3-oxopentanoate |
|---|---|
| PubChem CID | 118449429 |
| Molecular Formula | C16H31N3O4 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.23 |
| IUPAC Name | tert-butyl (4S)-4-[[(3S)-3,7-diamino-2-oxoheptyl]amino]-3-oxopentanoate |
| SMILES | C[C@H](NCC(=O)[C@@H](N)CCCCN)C(=O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H31N3O4/c1-11(13(20)9-15(22)23-16(2,3)4)19-10-14(21)12(18)7-5-6-8-17/h11-12,19H,5-10,17-18H2,1-4H3/t11-,12-/m0/s1 |
| InChIKey | SCWCHJPLBXZKSB-RYUDHWBXSA-N |
| XLogP | 0.29 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|