C20H21ClN2O3 — CID 118450066
N'-[2-(1-chloroethenyl)-5-[(3S)-oxolan-3-yl]oxy-4-phenylmethoxyphenyl]methanimidamide (PubChem CID 118450066) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is N'-[2-(1-chloroethenyl)-5-[(3S)-oxolan-3-yl]oxy-4-phenylmethoxyphenyl]methanimidamide.
| Compound Name | N'-[2-(1-chloroethenyl)-5-[(3S)-oxolan-3-yl]oxy-4-phenylmethoxyphenyl]methanimidamide |
|---|---|
| PubChem CID | 118450066 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N'-[2-(1-chloroethenyl)-5-[(3S)-oxolan-3-yl]oxy-4-phenylmethoxyphenyl]methanimidamide |
| SMILES | C=C(Cl)c1cc(OCc2ccccc2)c(O[C@H]2CCOC2)cc1/N=C/N |
| InChI | InChI=1S/C20H21ClN2O3/c1-14(21)17-9-19(25-11-15-5-3-2-4-6-15)20(10-18(17)23-13-22)26-16-7-8-24-12-16/h2-6,9-10,13,16H,1,7-8,11-12H2,(H2,22,23)/t16-/m0/s1 |
| InChIKey | ZQPCIGZTQLRZAJ-INIZCTEOSA-N |
| XLogP | 4.26 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|