C22H16N4O2S2 — CID 11845922
4-[3-cyano-4-phenyl-2-[(E)-thiophen-2-ylmethylideneamino]pyrrol-1-yl]benzenesulfonamide (PubChem CID 11845922) has the molecular formula C22H16N4O2S2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 4-[3-cyano-4-phenyl-2-[(E)-thiophen-2-ylmethylideneamino]pyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-cyano-4-phenyl-2-[(E)-thiophen-2-ylmethylideneamino]pyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 11845922 |
| Molecular Formula | C22H16N4O2S2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 4-[3-cyano-4-phenyl-2-[(E)-thiophen-2-ylmethylideneamino]pyrrol-1-yl]benzenesulfonamide |
| SMILES | N#Cc1c(-c2ccccc2)cn(-c2ccc(S(N)(=O)=O)cc2)c1/N=C/c1cccs1 |
| InChI | InChI=1S/C22H16N4O2S2/c23-13-20-21(16-5-2-1-3-6-16)15-26(22(20)25-14-18-7-4-12-29-18)17-8-10-19(11-9-17)30(24,27)28/h1-12,14-15H,(H2,24,27,28)/b25-14+ |
| InChIKey | FWIZJXSLJVQETL-AFUMVMLFSA-N |
| XLogP | 4.48 |
| TPSA | 101.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|