C22H24F3N3O4S2 — CID 118462185
ethyl 2-[[2-oxo-2-[[2-(trifluoromethyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylamino]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 118462185) has the molecular formula C22H24F3N3O4S2 and a molecular weight of 515.58 g/mol. Its IUPAC name is ethyl 2-[[2-oxo-2-[[2-(trifluoromethyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylamino]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-oxo-2-[[2-(trifluoromethyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylamino]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 118462185 |
| Molecular Formula | C22H24F3N3O4S2 |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | ethyl 2-[[2-oxo-2-[[2-(trifluoromethyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylamino]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(=O)NCc2c(C(F)(F)F)sc3c2CCNC3)sc2c1CCCC2 |
| InChI | InChI=1S/C22H24F3N3O4S2/c1-2-32-21(31)16-12-5-3-4-6-14(12)34-20(16)28-19(30)18(29)27-9-13-11-7-8-26-10-15(11)33-17(13)22(23,24)25/h26H,2-10H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | WXBVLRIWHNULMJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|