C26H33F2N3O3S2 — CID 138565075
ethyl 2-[[2-(1,1-difluoro-2-methylprop-2-enyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]-5,7-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 138565075) has the molecular formula C26H33F2N3O3S2 and a molecular weight of 537.70 g/mol. Its IUPAC name is ethyl 2-[[2-(1,1-difluoro-2-methylprop-2-enyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]-5,7-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(1,1-difluoro-2-methylprop-2-enyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]-5,7-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 138565075 |
| Molecular Formula | C26H33F2N3O3S2 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | ethyl 2-[[2-(1,1-difluoro-2-methylprop-2-enyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]-5,7-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | C=C(C)C(F)(F)c1sc2c(c1CNC(=O)Nc1sc3c(c1C(=O)OCC)CC(C)CC3C)CCNC2 |
| InChI | InChI=1S/C26H33F2N3O3S2/c1-6-34-24(32)20-17-10-14(4)9-15(5)21(17)36-23(20)31-25(33)30-11-18-16-7-8-29-12-19(16)35-22(18)26(27,28)13(2)3/h14-15,29H,2,6-12H2,1,3-5H3,(H2,30,31,33) |
| InChIKey | XAYRTAXZPRTGNS-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|