C23H28F2IN3O4S2 — CID 118462337
tert-butyl 2-[[2-[difluoro(iodo)methyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]-6-hydroxy-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 118462337) has the molecular formula C23H28F2IN3O4S2 and a molecular weight of 639.53 g/mol. Its IUPAC name is tert-butyl 2-[[2-[difluoro(iodo)methyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]-6-hydroxy-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | tert-butyl 2-[[2-[difluoro(iodo)methyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]-6-hydroxy-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 118462337 |
| Molecular Formula | C23H28F2IN3O4S2 |
| Molecular Weight | 639.53 g/mol |
| Exact Mass | 639.05 |
| IUPAC Name | tert-butyl 2-[[2-[difluoro(iodo)methyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]-6-hydroxy-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1c(NC(=O)NCc2c(C(F)(F)I)sc3c2CCNC3)sc2c1CCC(O)C2 |
| InChI | InChI=1S/C23H28F2IN3O4S2/c1-22(2,3)33-20(31)17-13-5-4-11(30)8-15(13)35-19(17)29-21(32)28-9-14-12-6-7-27-10-16(12)34-18(14)23(24,25)26/h11,27,30H,4-10H2,1-3H3,(H2,28,29,32) |
| InChIKey | QPKIYCMYRFRXOT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|