C23H31N3O4S2 — CID 126577308
tert-butyl 2-[(2-ethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl)methylcarbamoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate (PubChem CID 126577308) has the molecular formula C23H31N3O4S2 and a molecular weight of 477.65 g/mol. Its IUPAC name is tert-butyl 2-[(2-ethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl)methylcarbamoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate.
| Compound Name | tert-butyl 2-[(2-ethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl)methylcarbamoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate |
|---|---|
| PubChem CID | 126577308 |
| Molecular Formula | C23H31N3O4S2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | tert-butyl 2-[(2-ethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl)methylcarbamoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate |
| SMILES | CCc1sc2c(c1CNC(=O)Nc1sc3c(c1C(=O)OC(C)(C)C)CCOC3)CCNC2 |
| InChI | InChI=1S/C23H31N3O4S2/c1-5-16-15(13-6-8-24-11-17(13)31-16)10-25-22(28)26-20-19(21(27)30-23(2,3)4)14-7-9-29-12-18(14)32-20/h24H,5-12H2,1-4H3,(H2,25,26,28) |
| InChIKey | AKASXKYKYVNVTJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |