C28H32ClN3O3S2 — CID 118462203
tert-butyl 2-[[2-(3-chlorophenyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 118462203) has the molecular formula C28H32ClN3O3S2 and a molecular weight of 558.17 g/mol. Its IUPAC name is tert-butyl 2-[[2-(3-chlorophenyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | tert-butyl 2-[[2-(3-chlorophenyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 118462203 |
| Molecular Formula | C28H32ClN3O3S2 |
| Molecular Weight | 558.17 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | tert-butyl 2-[[2-(3-chlorophenyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1c(NC(=O)NCc2c(-c3cccc(Cl)c3)sc3c2CCNC3)sc2c1CCCC2 |
| InChI | InChI=1S/C28H32ClN3O3S2/c1-28(2,3)35-26(33)23-19-9-4-5-10-21(19)37-25(23)32-27(34)31-14-20-18-11-12-30-15-22(18)36-24(20)16-7-6-8-17(29)13-16/h6-8,13,30H,4-5,9-12,14-15H2,1-3H3,(H2,31,32,34) |
| InChIKey | KVPCIZMYFKTAPN-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.17 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |