C25H27N3O3S2 — CID 138564678
1-(3-formyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[[2-(3-methoxyphenyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methyl]urea (PubChem CID 138564678) has the molecular formula C25H27N3O3S2 and a molecular weight of 481.64 g/mol. Its IUPAC name is 1-(3-formyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[[2-(3-methoxyphenyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methyl]urea.
| Compound Name | 1-(3-formyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[[2-(3-methoxyphenyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 138564678 |
| Molecular Formula | C25H27N3O3S2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 1-(3-formyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[[2-(3-methoxyphenyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methyl]urea |
| SMILES | COc1cccc(-c2sc3c(c2CNC(=O)Nc2sc4c(c2C=O)CCCC4)CCNC3)c1 |
| InChI | InChI=1S/C25H27N3O3S2/c1-31-16-6-4-5-15(11-16)23-19(18-9-10-26-13-22(18)32-23)12-27-25(30)28-24-20(14-29)17-7-2-3-8-21(17)33-24/h4-6,11,14,26H,2-3,7-10,12-13H2,1H3,(H2,27,28,30) |
| InChIKey | OZJHOHIEVFTKHY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|