C24H23F2N3O2S2 — CID 138564938
1-[[2-(2,3-difluorophenyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methyl]-3-(3-formyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)urea (PubChem CID 138564938) has the molecular formula C24H23F2N3O2S2 and a molecular weight of 487.60 g/mol. Its IUPAC name is 1-[[2-(2,3-difluorophenyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methyl]-3-(3-formyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)urea.
| Compound Name | 1-[[2-(2,3-difluorophenyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methyl]-3-(3-formyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)urea |
|---|---|
| PubChem CID | 138564938 |
| Molecular Formula | C24H23F2N3O2S2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 1-[[2-(2,3-difluorophenyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methyl]-3-(3-formyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)urea |
| SMILES | O=Cc1c(NC(=O)NCc2c(-c3cccc(F)c3F)sc3c2CCNC3)sc2c1CCCC2 |
| InChI | InChI=1S/C24H23F2N3O2S2/c25-18-6-3-5-15(21(18)26)22-16(14-8-9-27-11-20(14)32-22)10-28-24(31)29-23-17(12-30)13-4-1-2-7-19(13)33-23/h3,5-6,12,27H,1-2,4,7-11H2,(H2,28,29,31) |
| InChIKey | BUTZQNLMBWKBDT-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|