C24H27N3O4S2 — CID 118462221
ethyl 2-[[2-(furan-3-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 118462221) has the molecular formula C24H27N3O4S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is ethyl 2-[[2-(furan-3-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(furan-3-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 118462221 |
| Molecular Formula | C24H27N3O4S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | ethyl 2-[[2-(furan-3-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)NCc2c(-c3ccoc3)sc3c2CCNC3)sc2c1CCCC2 |
| InChI | InChI=1S/C24H27N3O4S2/c1-2-31-23(28)20-16-5-3-4-6-18(16)33-22(20)27-24(29)26-11-17-15-7-9-25-12-19(15)32-21(17)14-8-10-30-13-14/h8,10,13,25H,2-7,9,11-12H2,1H3,(H2,26,27,29) |
| InChIKey | WVXJBVWMIQAFBC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |