C27H32N2O2S2 — CID 144946346
tert-butyl 2-[(2-phenyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl)methylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 144946346) has the molecular formula C27H32N2O2S2 and a molecular weight of 480.70 g/mol. Its IUPAC name is tert-butyl 2-[(2-phenyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl)methylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | tert-butyl 2-[(2-phenyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl)methylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 144946346 |
| Molecular Formula | C27H32N2O2S2 |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | tert-butyl 2-[(2-phenyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl)methylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1c(NCc2c(-c3ccccc3)sc3c2CCNC3)sc2c1CCCC2 |
| InChI | InChI=1S/C27H32N2O2S2/c1-27(2,3)31-26(30)23-19-11-7-8-12-21(19)33-25(23)29-15-20-18-13-14-28-16-22(18)32-24(20)17-9-5-4-6-10-17/h4-6,9-10,28-29H,7-8,11-16H2,1-3H3 |
| InChIKey | JMTHTRHKVPZFNN-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |