C19H22F3N3O3S2 — CID 118462327
ethyl 4,5-dimethyl-2-[[2-(trifluoromethyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]thiophene-3-carboxylate (PubChem CID 118462327) has the molecular formula C19H22F3N3O3S2 and a molecular weight of 461.53 g/mol. Its IUPAC name is ethyl 4,5-dimethyl-2-[[2-(trifluoromethyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 4,5-dimethyl-2-[[2-(trifluoromethyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 118462327 |
| Molecular Formula | C19H22F3N3O3S2 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | ethyl 4,5-dimethyl-2-[[2-(trifluoromethyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)NCc2c(C(F)(F)F)sc3c2CCNC3)sc(C)c1C |
| InChI | InChI=1S/C19H22F3N3O3S2/c1-4-28-17(26)14-9(2)10(3)29-16(14)25-18(27)24-7-12-11-5-6-23-8-13(11)30-15(12)19(20,21)22/h23H,4-8H2,1-3H3,(H2,24,25,27) |
| InChIKey | KJXCULLYLPJZMW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |