C20H26BrN3O3S2 — CID 126577157
tert-butyl 2-[(2-bromo-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl)methylcarbamoylamino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 126577157) has the molecular formula C20H26BrN3O3S2 and a molecular weight of 500.48 g/mol. Its IUPAC name is tert-butyl 2-[(2-bromo-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl)methylcarbamoylamino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | tert-butyl 2-[(2-bromo-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl)methylcarbamoylamino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 126577157 |
| Molecular Formula | C20H26BrN3O3S2 |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | tert-butyl 2-[(2-bromo-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl)methylcarbamoylamino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | Cc1sc(NC(=O)NCc2c(Br)sc3c2CCNC3)c(C(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C20H26BrN3O3S2/c1-10-11(2)28-17(15(10)18(25)27-20(3,4)5)24-19(26)23-8-13-12-6-7-22-9-14(12)29-16(13)21/h22H,6-9H2,1-5H3,(H2,23,24,26) |
| InChIKey | OXZCTDQGAGLKKO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |