C24H29Br2N3O4 — CID 11846296
(13S)-13-(4-aminobutyl)-5,20-dibromo-4-hydroxy-2-oxa-10,14-diazatricyclo[16.2.2.13,7]tricosa-1(20),3,5,7(23),18,21-hexaene-11,15-dione (PubChem CID 11846296) has the molecular formula C24H29Br2N3O4 and a molecular weight of 583.32 g/mol. Its IUPAC name is (13S)-13-(4-aminobutyl)-5,20-dibromo-4-hydroxy-2-oxa-10,14-diazatricyclo[16.2.2.13,7]tricosa-1(20),3,5,7(23),18,21-hexaene-11,15-dione.
| Compound Name | (13S)-13-(4-aminobutyl)-5,20-dibromo-4-hydroxy-2-oxa-10,14-diazatricyclo[16.2.2.13,7]tricosa-1(20),3,5,7(23),18,21-hexaene-11,15-dione |
|---|---|
| PubChem CID | 11846296 |
| Molecular Formula | C24H29Br2N3O4 |
| Molecular Weight | 583.32 g/mol |
| Exact Mass | 581.05 |
| IUPAC Name | (13S)-13-(4-aminobutyl)-5,20-dibromo-4-hydroxy-2-oxa-10,14-diazatricyclo[16.2.2.13,7]tricosa-1(20),3,5,7(23),18,21-hexaene-11,15-dione |
| SMILES | NCCCC[C@H]1CC(=O)NCCc2cc(Br)c(O)c(c2)Oc2ccc(cc2Br)CCC(=O)N1 |
| InChI | InChI=1S/C24H29Br2N3O4/c25-18-11-15-4-6-20(18)33-21-13-16(12-19(26)24(21)32)8-10-28-23(31)14-17(3-1-2-9-27)29-22(30)7-5-15/h4,6,11-13,17,32H,1-3,5,7-10,14,27H2,(H,28,31)(H,29,30)/t17-/m0/s1 |
| InChIKey | RSHDMRZOTMMUQH-KRWDZBQOSA-N |
| XLogP | 4.32 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|